PNG  IHDRQgAMA a cHRMz&u0`:pQ<bKGDgmIDATxwUﹻ& ^CX(J I@ "% (** BX +*i"]j(IH{~R)[~>h{}gy)I$Ij .I$I$ʊy@}x.: $I$Ii}VZPC)I$IF ^0ʐJ$I$Q^}{"r=OzI$gRZeC.IOvH eKX $IMpxsk.쒷/&r[޳<v| .I~)@$updYRa$I |M.e JaֶpSYR6j>h%IRز if&uJ)M$I vLi=H;7UJ,],X$I1AҒJ$ XY XzI@GNҥRT)E@;]K*Mw;#5_wOn~\ DC&$(A5 RRFkvIR}l!RytRl;~^ǷJj اy뷦BZJr&ӥ8Pjw~vnv X^(I;4R=P[3]J,]ȏ~:3?[ a&e)`e*P[4]T=Cq6R[ ~ޤrXR Հg(t_HZ-Hg M$ãmL5R uk*`%C-E6/%[t X.{8P9Z.vkXŐKjgKZHg(aK9ڦmKjѺm_ \#$5,)-  61eJ,5m| r'= &ڡd%-]J on Xm|{ RҞe $eڧY XYrԮ-a7RK6h>n$5AVڴi*ֆK)mѦtmr1p| q:흺,)Oi*ֺK)ܬ֦K-5r3>0ԔHjJئEZj,%re~/z%jVMڸmrt)3]J,T K֦OvԒgii*bKiNO~%PW0=dii2tJ9Jݕ{7"I P9JKTbu,%r"6RKU}Ij2HKZXJ,妝 XYrP ެ24c%i^IK|.H,%rb:XRl1X4Pe/`x&P8Pj28Mzsx2r\zRPz4J}yP[g=L) .Q[6RjWgp FIH*-`IMRaK9TXcq*I y[jE>cw%gLRԕiFCj-ďa`#e~I j,%r,)?[gp FI˨mnWX#>mʔ XA DZf9,nKҲzIZXJ,L#kiPz4JZF,I,`61%2s $,VOϚ2/UFJfy7K> X+6 STXIeJILzMfKm LRaK9%|4p9LwJI!`NsiazĔ)%- XMq>pk$-$Q2x#N ؎-QR}ᶦHZډ)J,l#i@yn3LN`;nڔ XuX5pF)m|^0(>BHF9(cզEerJI rg7 4I@z0\JIi䵙RR0s;$s6eJ,`n 䂦0a)S)A 1eJ,堌#635RIgpNHuTH_SԕqVe ` &S)>p;S$魁eKIuX`I4춒o}`m$1":PI<[v9^\pTJjriRŭ P{#{R2,`)e-`mgj~1ϣLKam7&U\j/3mJ,`F;M'䱀 .KR#)yhTq;pcK9(q!w?uRR,n.yw*UXj#\]ɱ(qv2=RqfB#iJmmL<]Y͙#$5 uTU7ӦXR+q,`I}qL'`6Kͷ6r,]0S$- [RKR3oiRE|nӦXR.(i:LDLTJjY%o:)6rxzҒqTJjh㞦I.$YR.ʼnGZ\ֿf:%55 I˼!6dKxm4E"mG_ s? .e*?LRfK9%q#uh$)i3ULRfK9yxm܌bj84$i1U^@Wbm4uJ,ҪA>_Ij?1v32[gLRD96oTaR׿N7%L2 NT,`)7&ƝL*꽙yp_$M2#AS,`)7$rkTA29_Iye"|/0t)$n XT2`YJ;6Jx".e<`$) PI$5V4]29SRI>~=@j]lp2`K9Jaai^" Ԋ29ORI%:XV5]JmN9]H;1UC39NI%Xe78t)a;Oi Ҙ>Xt"~G>_mn:%|~ޅ_+]$o)@ǀ{hgN;IK6G&rp)T2i୦KJuv*T=TOSV>(~D>dm,I*Ɛ:R#ۙNI%D>G.n$o;+#RR!.eU˽TRI28t)1LWϚ>IJa3oFbu&:tJ*(F7y0ZR ^p'Ii L24x| XRI%ۄ>S1]Jy[zL$adB7.eh4%%누>WETf+3IR:I3Xה)3אOۦSRO'ٺ)S}"qOr[B7ϙ.edG)^ETR"RtRݜh0}LFVӦDB^k_JDj\=LS(Iv─aTeZ%eUAM-0;~˃@i|l @S4y72>sX-vA}ϛBI!ݎߨWl*)3{'Y|iSlEڻ(5KtSI$Uv02,~ԩ~x;P4ցCrO%tyn425:KMlD ^4JRxSهF_}شJTS6uj+ﷸk$eZO%G*^V2u3EMj3k%)okI]dT)URKDS 7~m@TJR~荪fT"֛L \sM -0T KfJz+nإKr L&j()[E&I ߴ>e FW_kJR|!O:5/2跌3T-'|zX ryp0JS ~^F>-2< `*%ZFP)bSn"L :)+pʷf(pO3TMW$~>@~ū:TAIsV1}S2<%ޟM?@iT ,Eūoz%i~g|`wS(]oȤ8)$ ntu`өe`6yPl IzMI{ʣzʨ )IZ2= ld:5+請M$-ї;U>_gsY$ÁN5WzWfIZ)-yuXIfp~S*IZdt;t>KūKR|$#LcԀ+2\;kJ`]YǔM1B)UbG"IRߊ<xܾӔJ0Z='Y嵤 Leveg)$znV-º^3Ւof#0Tfk^Zs[*I꯳3{)ˬW4Ւ4 OdpbZRS|*I 55#"&-IvT&/윚Ye:i$ 9{LkuRe[I~_\ؠ%>GL$iY8 9ܕ"S`kS.IlC;Ҏ4x&>u_0JLr<J2(^$5L s=MgV ~,Iju> 7r2)^=G$1:3G< `J3~&IR% 6Tx/rIj3O< ʔ&#f_yXJiގNSz; Tx(i8%#4 ~AS+IjerIUrIj362v885+IjAhK__5X%nV%Iͳ-y|7XV2v4fzo_68"S/I-qbf; LkF)KSM$ Ms>K WNV}^`-큧32ŒVؙGdu,^^m%6~Nn&͓3ŒVZMsRpfEW%IwdǀLm[7W&bIRL@Q|)* i ImsIMmKmyV`i$G+R 0tV'!V)֏28vU7͒vHꦼtxꗞT ;S}7Mf+fIRHNZUkUx5SAJㄌ9MqμAIRi|j5)o*^'<$TwI1hEU^c_j?Е$%d`z cyf,XO IJnTgA UXRD }{H}^S,P5V2\Xx`pZ|Yk:$e ~ @nWL.j+ϝYb퇪bZ BVu)u/IJ_ 1[p.p60bC >|X91P:N\!5qUB}5a5ja `ubcVxYt1N0Zzl4]7­gKj]?4ϻ *[bg$)+À*x쳀ogO$~,5 زUS9 lq3+5mgw@np1sso Ӻ=|N6 /g(Wv7U;zωM=wk,0uTg_`_P`uz?2yI!b`kĸSo+Qx%!\οe|އԁKS-s6pu_(ֿ$i++T8=eY; צP+phxWQv*|p1. ά. XRkIQYP,drZ | B%wP|S5`~́@i޾ E;Չaw{o'Q?%iL{u D?N1BD!owPHReFZ* k_-~{E9b-~P`fE{AܶBJAFO wx6Rox5 K5=WwehS8 (JClJ~ p+Fi;ŗo+:bD#g(C"wA^ r.F8L;dzdIHUX݆ϞXg )IFqem%I4dj&ppT{'{HOx( Rk6^C٫O.)3:s(۳(Z?~ٻ89zmT"PLtw䥈5&b<8GZ-Y&K?e8,`I6e(֍xb83 `rzXj)F=l($Ij 2*(F?h(/9ik:I`m#p3MgLaKjc/U#n5S# m(^)=y=đx8ŬI[U]~SцA4p$-F i(R,7Cx;X=cI>{Km\ o(Tv2vx2qiiDJN,Ҏ!1f 5quBj1!8 rDFd(!WQl,gSkL1Bxg''՞^ǘ;pQ P(c_ IRujg(Wz bs#P­rz> k c&nB=q+ؔXn#r5)co*Ũ+G?7< |PQӣ'G`uOd>%Mctz# Ԫڞ&7CaQ~N'-P.W`Oedp03C!IZcIAMPUۀ5J<\u~+{9(FbbyAeBhOSܳ1 bÈT#ŠyDžs,`5}DC-`̞%r&ڙa87QWWp6e7 Rϫ/oY ꇅ Nܶըtc!LA T7V4Jsū I-0Pxz7QNF_iZgúWkG83 0eWr9 X]㾮݁#Jˢ C}0=3ݱtBi]_ &{{[/o[~ \q鯜00٩|cD3=4B_b RYb$óBRsf&lLX#M*C_L܄:gx)WΘsGSbuL rF$9';\4Ɍq'n[%p.Q`u hNb`eCQyQ|l_C>Lb꟟3hSb #xNxSs^ 88|Mz)}:](vbۢamŖ࿥ 0)Q7@0=?^k(*J}3ibkFn HjB׻NO z x}7p 0tfDX.lwgȔhԾŲ }6g E |LkLZteu+=q\Iv0쮑)QٵpH8/2?Σo>Jvppho~f>%bMM}\//":PTc(v9v!gոQ )UfVG+! 35{=x\2+ki,y$~A1iC6#)vC5^>+gǵ@1Hy٪7u;p psϰu/S <aʸGu'tD1ԝI<pg|6j'p:tպhX{o(7v],*}6a_ wXRk,O]Lܳ~Vo45rp"N5k;m{rZbΦ${#)`(Ŵg,;j%6j.pyYT?}-kBDc3qA`NWQū20/^AZW%NQ MI.X#P#,^Ebc&?XR tAV|Y.1!؅⨉ccww>ivl(JT~ u`ٵDm q)+Ri x/x8cyFO!/*!/&,7<.N,YDŽ&ܑQF1Bz)FPʛ?5d 6`kQձ λc؎%582Y&nD_$Je4>a?! ͨ|ȎWZSsv8 j(I&yj Jb5m?HWp=g}G3#|I,5v珿] H~R3@B[☉9Ox~oMy=J;xUVoj bUsl_35t-(ՃɼRB7U!qc+x4H_Qo֮$[GO<4`&č\GOc[.[*Af%mG/ ňM/r W/Nw~B1U3J?P&Y )`ѓZ1p]^l“W#)lWZilUQu`-m|xĐ,_ƪ|9i:_{*(3Gѧ}UoD+>m_?VPۅ15&}2|/pIOʵ> GZ9cmíتmnz)yߐbD >e}:) r|@R5qVSA10C%E_'^8cR7O;6[eKePGϦX7jb}OTGO^jn*媓7nGMC t,k31Rb (vyܴʭ!iTh8~ZYZp(qsRL ?b}cŨʊGO^!rPJO15MJ[c&~Z`"ѓޔH1C&^|Ш|rʼ,AwĴ?b5)tLU)F| &g٣O]oqSUjy(x<Ϳ3 .FSkoYg2 \_#wj{u'rQ>o;%n|F*O_L"e9umDds?.fuuQbIWz |4\0 sb;OvxOSs; G%T4gFRurj(֍ڑb uԖKDu1MK{1^ q; C=6\8FR艇!%\YÔU| 88m)֓NcLve C6z;o&X x59:q61Z(T7>C?gcļxѐ Z oo-08jہ x,`' ҔOcRlf~`jj".Nv+sM_]Zk g( UOPyεx%pUh2(@il0ݽQXxppx-NS( WO+轾 nFߢ3M<;z)FBZjciu/QoF 7R¥ ZFLF~#ȣߨ^<쩡ݛкvџ))ME>ώx4m#!-m!L;vv#~Y[đKmx9.[,UFS CVkZ +ߟrY٧IZd/ioi$%͝ب_ֶX3ܫhNU ZZgk=]=bbJS[wjU()*I =ώ:}-蹞lUj:1}MWm=̛ _ ¾,8{__m{_PVK^n3esw5ӫh#$-q=A̟> ,^I}P^J$qY~Q[ Xq9{#&T.^GVj__RKpn,b=`żY@^՝;z{paVKkQXj/)y TIc&F;FBG7wg ZZDG!x r_tƢ!}i/V=M/#nB8 XxЫ ^@CR<{䤭YCN)eKOSƟa $&g[i3.C6xrOc8TI;o hH6P&L{@q6[ Gzp^71j(l`J}]e6X☉#͕ ׈$AB1Vjh㭦IRsqFBjwQ_7Xk>y"N=MB0 ,C #o6MRc0|$)ف"1!ixY<B9mx `,tA>)5ػQ?jQ?cn>YZe Tisvh# GMމȇp:ԴVuږ8ɼH]C.5C!UV;F`mbBk LTMvPʍϤj?ԯ/Qr1NB`9s"s TYsz &9S%U԰> {<ؿSMxB|H\3@!U| k']$U+> |HHMLޢ?V9iD!-@x TIî%6Z*9X@HMW#?nN ,oe6?tQwڱ.]-y':mW0#!J82qFjH -`ѓ&M0u Uγmxϵ^-_\])@0Rt.8/?ٰCY]x}=sD3ojަЫNuS%U}ԤwHH>ڗjܷ_3gN q7[q2la*ArǓԖ+p8/RGM ]jacd(JhWko6ڎbj]i5Bj3+3!\j1UZLsLTv8HHmup<>gKMJj0@H%,W΃7R) ">c, xixј^ aܖ>H[i.UIHc U1=yW\=S*GR~)AF=`&2h`DzT󑓶J+?W+}C%P:|0H܆}-<;OC[~o.$~i}~HQ TvXΈr=b}$vizL4:ȰT|4~*!oXQR6Lk+#t/g lԁߖ[Jڶ_N$k*". xsxX7jRVbAAʯKҎU3)zSNN _'s?f)6X!%ssAkʱ>qƷb hg %n ~p1REGMHH=BJiy[<5 ǁJҖgKR*倳e~HUy)Ag,K)`Vw6bRR:qL#\rclK/$sh*$ 6덤 KԖc 3Z9=Ɣ=o>X Ώ"1 )a`SJJ6k(<c e{%kϊP+SL'TcMJWRm ŏ"w)qc ef꒵i?b7b('"2r%~HUS1\<(`1Wx9=8HY9m:X18bgD1u ~|H;K-Uep,, C1 RV.MR5άh,tWO8WC$ XRVsQS]3GJ|12 [vM :k#~tH30Rf-HYݺ-`I9%lIDTm\ S{]9gOڒMNCV\G*2JRŨ;Rҏ^ڽ̱mq1Eu?To3I)y^#jJw^Ńj^vvlB_⋌P4x>0$c>K†Aļ9s_VjTt0l#m>E-,,x,-W)سo&96RE XR.6bXw+)GAEvL)͞K4$p=Ũi_ѱOjb HY/+@θH9޼]Nԥ%n{ &zjT? Ty) s^ULlb,PiTf^<À] 62R^V7)S!nllS6~͝V}-=%* ʻ>G DnK<y&>LPy7'r=Hj 9V`[c"*^8HpcO8bnU`4JȪAƋ#1_\ XϘHPRgik(~G~0DAA_2p|J묭a2\NCr]M_0 ^T%e#vD^%xy-n}-E\3aS%yN!r_{ )sAw ڼp1pEAk~v<:`'ӭ^5 ArXOI驻T (dk)_\ PuA*BY]yB"l\ey hH*tbK)3 IKZ򹞋XjN n *n>k]X_d!ryBH ]*R 0(#'7 %es9??ښFC,ՁQPjARJ\Ρw K#jahgw;2$l*) %Xq5!U᢯6Re] |0[__64ch&_}iL8KEgҎ7 M/\`|.p,~`a=BR?xܐrQ8K XR2M8f ?`sgWS%" Ԉ 7R%$ N}?QL1|-эټwIZ%pvL3Hk>,ImgW7{E xPHx73RA @RS CC !\ȟ5IXR^ZxHл$Q[ŝ40 (>+ _C >BRt<,TrT {O/H+˟Pl6 I B)/VC<6a2~(XwV4gnXR ϱ5ǀHٻ?tw똤Eyxp{#WK qG%5],(0ӈH HZ])ג=K1j&G(FbM@)%I` XRg ʔ KZG(vP,<`[ Kn^ SJRsAʠ5xՅF`0&RbV tx:EaUE/{fi2;.IAwW8/tTxAGOoN?G}l L(n`Zv?pB8K_gI+ܗ #i?ޙ.) p$utc ~DžfՈEo3l/)I-U?aԅ^jxArA ΧX}DmZ@QLےbTXGd.^|xKHR{|ΕW_h] IJ`[G9{).y) 0X YA1]qp?p_k+J*Y@HI>^?gt.06Rn ,` ?);p pSF9ZXLBJPWjgQ|&)7! HjQt<| ؅W5 x W HIzYoVMGP Hjn`+\(dNW)F+IrS[|/a`K|ͻ0Hj{R,Q=\ (F}\WR)AgSG`IsnAR=|8$}G(vC$)s FBJ?]_u XRvύ6z ŨG[36-T9HzpW̞ú Xg큽=7CufzI$)ki^qk-) 0H*N` QZkk]/tnnsI^Gu't=7$ Z;{8^jB% IItRQS7[ϭ3 $_OQJ`7!]W"W,)Iy W AJA;KWG`IY{8k$I$^%9.^(`N|LJ%@$I}ֽp=FB*xN=gI?Q{٥4B)mw $Igc~dZ@G9K X?7)aK%݅K$IZ-`IpC U6$I\0>!9k} Xa IIS0H$I H ?1R.Чj:4~Rw@p$IrA*u}WjWFPJ$I➓/6#! LӾ+ X36x8J |+L;v$Io4301R20M I$-E}@,pS^ޟR[/s¹'0H$IKyfŸfVOπFT*a$I>He~VY/3R/)>d$I>28`Cjw,n@FU*9ttf$I~<;=/4RD~@ X-ѕzἱI$: ԍR a@b X{+Qxuq$IЛzo /~3\8ڒ4BN7$IҀj V]n18H$IYFBj3̵̚ja pp $Is/3R Ӻ-Yj+L;.0ŔI$Av? #!5"aʄj}UKmɽH$IjCYs?h$IDl843.v}m7UiI=&=0Lg0$I4: embe` eQbm0u? $IT!Sƍ'-sv)s#C0:XB2a w I$zbww{."pPzO =Ɔ\[ o($Iaw]`E).Kvi:L*#gР7[$IyGPI=@R 4yR~̮´cg I$I/<tPͽ hDgo 94Z^k盇΄8I56^W$I^0̜N?4*H`237}g+hxoq)SJ@p|` $I%>-hO0eO>\ԣNߌZD6R=K ~n($I$y3D>o4b#px2$yڪtzW~a $I~?x'BwwpH$IZݑnC㧄Pc_9sO gwJ=l1:mKB>Ab<4Lp$Ib o1ZQ@85b̍ S'F,Fe,^I$IjEdù{l4 8Ys_s Z8.x m"+{~?q,Z D!I$ϻ'|XhB)=…']M>5 rgotԎ 獽PH$IjIPhh)n#cÔqA'ug5qwU&rF|1E%I$%]!'3AFD/;Ck_`9 v!ٴtPV;x`'*bQa w I$Ix5 FC3D_~A_#O݆DvV?<qw+I$I{=Z8".#RIYyjǪ=fDl9%M,a8$I$Ywi[7ݍFe$s1ՋBVA?`]#!oz4zjLJo8$I$%@3jAa4(o ;p,,dya=F9ً[LSPH$IJYЉ+3> 5"39aZ<ñh!{TpBGkj}Sp $IlvF.F$I z< '\K*qq.f<2Y!S"-\I$IYwčjF$ w9 \ߪB.1v!Ʊ?+r:^!I$BϹB H"B;L'G[ 4U#5>੐)|#o0aڱ$I>}k&1`U#V?YsV x>{t1[I~D&(I$I/{H0fw"q"y%4 IXyE~M3 8XψL}qE$I[> nD?~sf ]o΁ cT6"?'_Ἣ $I>~.f|'!N?⟩0G KkXZE]ޡ;/&?k OۘH$IRۀwXӨ<7@PnS04aӶp.:@\IWQJ6sS%I$e5ڑv`3:x';wq_vpgHyXZ 3gЂ7{{EuԹn±}$I$8t;b|591nءQ"P6O5i }iR̈́%Q̄p!I䮢]O{H$IRϻ9s֧ a=`- aB\X0"+5"C1Hb?߮3x3&gşggl_hZ^,`5?ߎvĸ%̀M!OZC2#0x LJ0 Gw$I$I}<{Eb+y;iI,`ܚF:5ܛA8-O-|8K7s|#Z8a&><a&/VtbtLʌI$I$I$I$I$I$IRjDD%tEXtdate:create2022-05-31T04:40:26+00:00!Î%tEXtdate:modify2022-05-31T04:40:26+00:00|{2IENDB`Mini Shell

HOME


Mini Shell 1.0
DIR:/proc/self/root/proc/self/root/proc/self/root/opt/cpanel/ea-nodejs22/include/node/
Upload File :
Current File : //proc/self/root/proc/self/root/proc/self/root/opt/cpanel/ea-nodejs22/include/node/v8-script.h
// Copyright 2021 the V8 project authors. All rights reserved.
// Use of this source code is governed by a BSD-style license that can be
// found in the LICENSE file.

#ifndef INCLUDE_V8_SCRIPT_H_
#define INCLUDE_V8_SCRIPT_H_

#include <stddef.h>
#include <stdint.h>

#include <memory>
#include <tuple>
#include <vector>

#include "v8-callbacks.h"     // NOLINT(build/include_directory)
#include "v8-data.h"          // NOLINT(build/include_directory)
#include "v8-local-handle.h"  // NOLINT(build/include_directory)
#include "v8-maybe.h"         // NOLINT(build/include_directory)
#include "v8-memory-span.h"   // NOLINT(build/include_directory)
#include "v8-message.h"       // NOLINT(build/include_directory)
#include "v8config.h"         // NOLINT(build/include_directory)

namespace v8 {

class Function;
class Message;
class Object;
class PrimitiveArray;
class Script;

namespace internal {
class BackgroundDeserializeTask;
struct ScriptStreamingData;
}  // namespace internal

/**
 * A container type that holds relevant metadata for module loading.
 *
 * This is passed back to the embedder as part of
 * HostImportModuleDynamicallyCallback for module loading.
 */
class V8_EXPORT ScriptOrModule {
 public:
  /**
   * The name that was passed by the embedder as ResourceName to the
   * ScriptOrigin. This can be either a v8::String or v8::Undefined.
   */
  Local<Value> GetResourceName();

  /**
   * The options that were passed by the embedder as HostDefinedOptions to
   * the ScriptOrigin.
   */
  Local<Data> HostDefinedOptions();
};

/**
 * A compiled JavaScript script, not yet tied to a Context.
 */
class V8_EXPORT UnboundScript : public Data {
 public:
  /**
   * Binds the script to the currently entered context.
   */
  Local<Script> BindToCurrentContext();

  int GetId() const;
  Local<Value> GetScriptName();

  /**
   * Data read from magic sourceURL comments.
   */
  Local<Value> GetSourceURL();
  /**
   * Data read from magic sourceMappingURL comments.
   */
  Local<Value> GetSourceMappingURL();

  /**
   * Returns zero based line number of the code_pos location in the script.
   * -1 will be returned if no information available.
   */
  int GetLineNumber(int code_pos = 0);

  /**
   * Returns zero based column number of the code_pos location in the script.
   * -1 will be returned if no information available.
   */
  int GetColumnNumber(int code_pos = 0);

  static const int kNoScriptId = 0;
};

/**
 * A compiled JavaScript module, not yet tied to a Context.
 */
class V8_EXPORT UnboundModuleScript : public Data {
 public:
  /**
   * Data read from magic sourceURL comments.
   */
  Local<Value> GetSourceURL();
  /**
   * Data read from magic sourceMappingURL comments.
   */
  Local<Value> GetSourceMappingURL();
};

/**
 * A location in JavaScript source.
 */
class V8_EXPORT Location {
 public:
  int GetLineNumber() { return line_number_; }
  int GetColumnNumber() { return column_number_; }

  Location(int line_number, int column_number)
      : line_number_(line_number), column_number_(column_number) {}

 private:
  int line_number_;
  int column_number_;
};

class V8_EXPORT ModuleRequest : public Data {
 public:
  /**
   * Returns the module specifier for this ModuleRequest.
   */
  Local<String> GetSpecifier() const;

  /**
   * Returns the source code offset of this module request.
   * Use Module::SourceOffsetToLocation to convert this to line/column numbers.
   */
  int GetSourceOffset() const;

  /**
   * Contains the import attributes for this request in the form:
   * [key1, value1, source_offset1, key2, value2, source_offset2, ...].
   * The keys and values are of type v8::String, and the source offsets are of
   * type Int32. Use Module::SourceOffsetToLocation to convert the source
   * offsets to Locations with line/column numbers.
   *
   * All attributes present in the module request will be supplied in this
   * list, regardless of whether they are supported by the host. Per
   * https://tc39.es/proposal-import-attributes/#sec-hostgetsupportedimportattributes,
   * hosts are expected to throw for attributes that they do not support (as
   * opposed to, for example, ignoring them).
   */
  Local<FixedArray> GetImportAttributes() const;

  V8_DEPRECATE_SOON("Use GetImportAttributes instead")
  Local<FixedArray> GetImportAssertions() const {
    return GetImportAttributes();
  }

  V8_INLINE static ModuleRequest* Cast(Data* data);

 private:
  static void CheckCast(Data* obj);
};

/**
 * A compiled JavaScript module.
 */
class V8_EXPORT Module : public Data {
 public:
  /**
   * The different states a module can be in.
   *
   * This corresponds to the states used in ECMAScript except that "evaluated"
   * is split into kEvaluated and kErrored, indicating success and failure,
   * respectively.
   */
  enum Status {
    kUninstantiated,
    kInstantiating,
    kInstantiated,
    kEvaluating,
    kEvaluated,
    kErrored
  };

  /**
   * Returns the module's current status.
   */
  Status GetStatus() const;

  /**
   * For a module in kErrored status, this returns the corresponding exception.
   */
  Local<Value> GetException() const;

  /**
   * Returns the ModuleRequests for this module.
   */
  Local<FixedArray> GetModuleRequests() const;

  /**
   * For the given source text offset in this module, returns the corresponding
   * Location with line and column numbers.
   */
  Location SourceOffsetToLocation(int offset) const;

  /**
   * Returns the identity hash for this object.
   */
  int GetIdentityHash() const;

  using ResolveModuleCallback = MaybeLocal<Module> (*)(
      Local<Context> context, Local<String> specifier,
      Local<FixedArray> import_assertions, Local<Module> referrer);

  /**
   * Instantiates the module and its dependencies.
   *
   * Returns an empty Maybe<bool> if an exception occurred during
   * instantiation. (In the case where the callback throws an exception, that
   * exception is propagated.)
   */
  V8_WARN_UNUSED_RESULT Maybe<bool> InstantiateModule(
      Local<Context> context, ResolveModuleCallback callback);

  /**
   * Evaluates the module and its dependencies.
   *
   * If status is kInstantiated, run the module's code and return a Promise
   * object. On success, set status to kEvaluated and resolve the Promise with
   * the completion value; on failure, set status to kErrored and reject the
   * Promise with the error.
   *
   * If IsGraphAsync() is false, the returned Promise is settled.
   */
  V8_WARN_UNUSED_RESULT MaybeLocal<Value> Evaluate(Local<Context> context);

  /**
   * Returns the namespace object of this module.
   *
   * The module's status must be at least kInstantiated.
   */
  Local<Value> GetModuleNamespace();

  /**
   * Returns the corresponding context-unbound module script.
   *
   * The module must be unevaluated, i.e. its status must not be kEvaluating,
   * kEvaluated or kErrored.
   */
  Local<UnboundModuleScript> GetUnboundModuleScript();

  /**
   * Returns the underlying script's id.
   *
   * The module must be a SourceTextModule and must not have a kErrored status.
   */
  int ScriptId() const;

  /**
   * Returns whether this module or any of its requested modules is async,
   * i.e. contains top-level await.
   *
   * The module's status must be at least kInstantiated.
   */
  bool IsGraphAsync() const;

  /**
   * Returns whether the module is a SourceTextModule.
   */
  bool IsSourceTextModule() const;

  /**
   * Returns whether the module is a SyntheticModule.
   */
  bool IsSyntheticModule() const;

  /*
   * Callback defined in the embedder.  This is responsible for setting
   * the module's exported values with calls to SetSyntheticModuleExport().
   * The callback must return a resolved Promise to indicate success (where no
   * exception was thrown) and return an empy MaybeLocal to indicate falure
   * (where an exception was thrown).
   */
  using SyntheticModuleEvaluationSteps =
      MaybeLocal<Value> (*)(Local<Context> context, Local<Module> module);

  /**
   * Creates a new SyntheticModule with the specified export names, where
   * evaluation_steps will be executed upon module evaluation.
   * export_names must not contain duplicates.
   * module_name is used solely for logging/debugging and doesn't affect module
   * behavior.
   */
  static Local<Module> CreateSyntheticModule(
      Isolate* isolate, Local<String> module_name,
      const MemorySpan<const Local<String>>& export_names,
      SyntheticModuleEvaluationSteps evaluation_steps);

  /**
   * Set this module's exported value for the name export_name to the specified
   * export_value. This method must be called only on Modules created via
   * CreateSyntheticModule.  An error will be thrown if export_name is not one
   * of the export_names that were passed in that CreateSyntheticModule call.
   * Returns Just(true) on success, Nothing<bool>() if an error was thrown.
   */
  V8_WARN_UNUSED_RESULT Maybe<bool> SetSyntheticModuleExport(
      Isolate* isolate, Local<String> export_name, Local<Value> export_value);

  /**
   * Search the modules requested directly or indirectly by the module for
   * any top-level await that has not yet resolved. If there is any, the
   * returned pair of vectors (of equal size) contain the unresolved module
   * and corresponding message with the pending top-level await.
   * An embedder may call this before exiting to improve error messages.
   */
  std::pair<LocalVector<Module>, LocalVector<Message>>
  GetStalledTopLevelAwaitMessages(Isolate* isolate);

  V8_INLINE static Module* Cast(Data* data);

 private:
  static void CheckCast(Data* obj);
};

/**
 * A compiled JavaScript script, tied to a Context which was active when the
 * script was compiled.
 */
class V8_EXPORT Script : public Data {
 public:
  /**
   * A shorthand for ScriptCompiler::Compile().
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
      Local<Context> context, Local<String> source,
      ScriptOrigin* origin = nullptr);

  /**
   * Runs the script returning the resulting value. It will be run in the
   * context in which it was created (ScriptCompiler::CompileBound or
   * UnboundScript::BindToCurrentContext()).
   */
  V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context);
  V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context,
                                              Local<Data> host_defined_options);

  /**
   * Returns the corresponding context-unbound script.
   */
  Local<UnboundScript> GetUnboundScript();

  /**
   * The name that was passed by the embedder as ResourceName to the
   * ScriptOrigin. This can be either a v8::String or v8::Undefined.
   */
  Local<Value> GetResourceName();

  /**
   * If the script was compiled, returns the positions of lazy functions which
   * were eventually compiled and executed.
   */
  std::vector<int> GetProducedCompileHints() const;
};

enum class ScriptType { kClassic, kModule };

/**
 * For compiling scripts.
 */
class V8_EXPORT ScriptCompiler {
 public:
  class ConsumeCodeCacheTask;

  /**
   * Compilation data that the embedder can cache and pass back to speed up
   * future compilations. The data is produced if the CompilerOptions passed to
   * the compilation functions in ScriptCompiler contains produce_data_to_cache
   * = true. The data to cache can then can be retrieved from
   * UnboundScript.
   */
  struct V8_EXPORT CachedData {
    enum BufferPolicy { BufferNotOwned, BufferOwned };

    CachedData()
        : data(nullptr),
          length(0),
          rejected(false),
          buffer_policy(BufferNotOwned) {}

    // If buffer_policy is BufferNotOwned, the caller keeps the ownership of
    // data and guarantees that it stays alive until the CachedData object is
    // destroyed. If the policy is BufferOwned, the given data will be deleted
    // (with delete[]) when the CachedData object is destroyed.
    CachedData(const uint8_t* data, int length,
               BufferPolicy buffer_policy = BufferNotOwned);
    ~CachedData();

    enum CompatibilityCheckResult {
      // Don't change order/existing values of this enum since it keys into the
      // `code_cache_reject_reason` histogram. Append-only!
      kSuccess = 0,
      kMagicNumberMismatch = 1,
      kVersionMismatch = 2,
      kSourceMismatch = 3,
      kFlagsMismatch = 5,
      kChecksumMismatch = 6,
      kInvalidHeader = 7,
      kLengthMismatch = 8,
      kReadOnlySnapshotChecksumMismatch = 9,

      // This should always point at the last real enum value.
      kLast = kReadOnlySnapshotChecksumMismatch
    };

    // Check if the CachedData can be loaded in the given isolate.
    CompatibilityCheckResult CompatibilityCheck(Isolate* isolate);

    // TODO(marja): Async compilation; add constructors which take a callback
    // which will be called when V8 no longer needs the data.
    const uint8_t* data;
    int length;
    bool rejected;
    BufferPolicy buffer_policy;

    // Prevent copying.
    CachedData(const CachedData&) = delete;
    CachedData& operator=(const CachedData&) = delete;
  };

  enum class InMemoryCacheResult {
    // V8 did not attempt to find this script in its in-memory cache.
    kNotAttempted,

    // V8 found a previously compiled copy of this script in its in-memory
    // cache. Any data generated by a streaming compilation or background
    // deserialization was abandoned.
    kHit,

    // V8 didn't have any previously compiled data for this script.
    kMiss,

    // V8 had some previously compiled data for an identical script, but the
    // data was incomplete.
    kPartial,
  };

  // Details about what happened during a compilation.
  struct CompilationDetails {
    InMemoryCacheResult in_memory_cache_result =
        InMemoryCacheResult::kNotAttempted;

    static constexpr int64_t kTimeNotMeasured = -1;
    int64_t foreground_time_in_microseconds = kTimeNotMeasured;
    int64_t background_time_in_microseconds = kTimeNotMeasured;
  };

  /**
   * Source code which can be then compiled to a UnboundScript or Script.
   */
  class Source {
   public:
    // Source takes ownership of both CachedData and CodeCacheConsumeTask.
    // The caller *must* ensure that the cached data is from a trusted source.
    V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin,
                     CachedData* cached_data = nullptr,
                     ConsumeCodeCacheTask* consume_cache_task = nullptr);
    // Source takes ownership of both CachedData and CodeCacheConsumeTask.
    V8_INLINE explicit Source(
        Local<String> source_string, CachedData* cached_data = nullptr,
        ConsumeCodeCacheTask* consume_cache_task = nullptr);
    V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin,
                     CompileHintCallback callback, void* callback_data);
    V8_INLINE ~Source() = default;

    // Ownership of the CachedData or its buffers is *not* transferred to the
    // caller. The CachedData object is alive as long as the Source object is
    // alive.
    V8_INLINE const CachedData* GetCachedData() const;

    V8_INLINE const ScriptOriginOptions& GetResourceOptions() const;

    V8_INLINE const CompilationDetails& GetCompilationDetails() const;

   private:
    friend class ScriptCompiler;

    Local<String> source_string;

    // Origin information
    Local<Value> resource_name;
    int resource_line_offset = -1;
    int resource_column_offset = -1;
    ScriptOriginOptions resource_options;
    Local<Value> source_map_url;
    Local<Data> host_defined_options;

    // Cached data from previous compilation (if a kConsume*Cache flag is
    // set), or hold newly generated cache data (kProduce*Cache flags) are
    // set when calling a compile method.
    std::unique_ptr<CachedData> cached_data;
    std::unique_ptr<ConsumeCodeCacheTask> consume_cache_task;

    // For requesting compile hints from the embedder.
    CompileHintCallback compile_hint_callback = nullptr;
    void* compile_hint_callback_data = nullptr;

    // V8 writes this data and never reads it. It exists only to be informative
    // to the embedder.
    CompilationDetails compilation_details;
  };

  /**
   * For streaming incomplete script data to V8. The embedder should implement a
   * subclass of this class.
   */
  class V8_EXPORT ExternalSourceStream {
   public:
    virtual ~ExternalSourceStream() = default;

    /**
     * V8 calls this to request the next chunk of data from the embedder. This
     * function will be called on a background thread, so it's OK to block and
     * wait for the data, if the embedder doesn't have data yet. Returns the
     * length of the data returned. When the data ends, GetMoreData should
     * return 0. Caller takes ownership of the data.
     *
     * When streaming UTF-8 data, V8 handles multi-byte characters split between
     * two data chunks, but doesn't handle multi-byte characters split between
     * more than two data chunks. The embedder can avoid this problem by always
     * returning at least 2 bytes of data.
     *
     * When streaming UTF-16 data, V8 does not handle characters split between
     * two data chunks. The embedder has to make sure that chunks have an even
     * length.
     *
     * If the embedder wants to cancel the streaming, they should make the next
     * GetMoreData call return 0. V8 will interpret it as end of data (and most
     * probably, parsing will fail). The streaming task will return as soon as
     * V8 has parsed the data it received so far.
     */
    virtual size_t GetMoreData(const uint8_t** src) = 0;
  };

  /**
   * Source code which can be streamed into V8 in pieces. It will be parsed
   * while streaming and compiled after parsing has completed. StreamedSource
   * must be kept alive while the streaming task is run (see ScriptStreamingTask
   * below).
   */
  class V8_EXPORT StreamedSource {
   public:
    enum Encoding { ONE_BYTE, TWO_BYTE, UTF8, WINDOWS_1252 };

    StreamedSource(std::unique_ptr<ExternalSourceStream> source_stream,
                   Encoding encoding);
    ~StreamedSource();

    internal::ScriptStreamingData* impl() const { return impl_.get(); }

    // Prevent copying.
    StreamedSource(const StreamedSource&) = delete;
    StreamedSource& operator=(const StreamedSource&) = delete;

    CompilationDetails& compilation_details() { return compilation_details_; }

   private:
    std::unique_ptr<internal::ScriptStreamingData> impl_;

    // V8 writes this data and never reads it. It exists only to be informative
    // to the embedder.
    CompilationDetails compilation_details_;
  };

  /**
   * A streaming task which the embedder must run on a background thread to
   * stream scripts into V8. Returned by ScriptCompiler::StartStreaming.
   */
  class V8_EXPORT ScriptStreamingTask final {
   public:
    void Run();

   private:
    friend class ScriptCompiler;

    explicit ScriptStreamingTask(internal::ScriptStreamingData* data)
        : data_(data) {}

    internal::ScriptStreamingData* data_;
  };

  /**
   * A task which the embedder must run on a background thread to
   * consume a V8 code cache. Returned by
   * ScriptCompiler::StartConsumingCodeCache.
   */
  class V8_EXPORT ConsumeCodeCacheTask final {
   public:
    ~ConsumeCodeCacheTask();

    void Run();

    /**
     * Provides the source text string and origin information to the consumption
     * task. May be called before, during, or after Run(). This step checks
     * whether the script matches an existing script in the Isolate's
     * compilation cache. To check whether such a script was found, call
     * ShouldMergeWithExistingScript.
     *
     * The Isolate provided must be the same one used during
     * StartConsumingCodeCache and must be currently entered on the thread that
     * calls this function. The source text and origin provided in this step
     * must precisely match those used later in the ScriptCompiler::Source that
     * will contain this ConsumeCodeCacheTask.
     */
    void SourceTextAvailable(Isolate* isolate, Local<String> source_text,
                             const ScriptOrigin& origin);

    /**
     * Returns whether the embedder should call MergeWithExistingScript. This
     * function may be called from any thread, any number of times, but its
     * return value is only meaningful after SourceTextAvailable has completed.
     */
    bool ShouldMergeWithExistingScript() const;

    /**
     * Merges newly deserialized data into an existing script which was found
     * during SourceTextAvailable. May be called only after Run() has completed.
     * Can execute on any thread, like Run().
     */
    void MergeWithExistingScript();

   private:
    friend class ScriptCompiler;

    explicit ConsumeCodeCacheTask(
        std::unique_ptr<internal::BackgroundDeserializeTask> impl);

    std::unique_ptr<internal::BackgroundDeserializeTask> impl_;
  };

  enum CompileOptions {
    kNoCompileOptions = 0,
    kConsumeCodeCache,
    kEagerCompile,
    kProduceCompileHints,
    kConsumeCompileHints
  };

  /**
   * The reason for which we are not requesting or providing a code cache.
   */
  enum NoCacheReason {
    kNoCacheNoReason = 0,
    kNoCacheBecauseCachingDisabled,
    kNoCacheBecauseNoResource,
    kNoCacheBecauseInlineScript,
    kNoCacheBecauseModule,
    kNoCacheBecauseStreamingSource,
    kNoCacheBecauseInspector,
    kNoCacheBecauseScriptTooSmall,
    kNoCacheBecauseCacheTooCold,
    kNoCacheBecauseV8Extension,
    kNoCacheBecauseExtensionModule,
    kNoCacheBecausePacScript,
    kNoCacheBecauseInDocumentWrite,
    kNoCacheBecauseResourceWithNoCacheHandler,
    kNoCacheBecauseDeferredProduceCodeCache
  };

  /**
   * Compiles the specified script (context-independent).
   * Cached data as part of the source object can be optionally produced to be
   * consumed later to speed up compilation of identical source scripts.
   *
   * Note that when producing cached data, the source must point to NULL for
   * cached data. When consuming cached data, the cached data must have been
   * produced by the same version of V8, and the embedder needs to ensure the
   * cached data is the correct one for the given script.
   *
   * \param source Script source code.
   * \return Compiled script object (context independent; for running it must be
   *   bound to a context).
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript(
      Isolate* isolate, Source* source,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Compiles the specified script (bound to current context).
   *
   * \param source Script source code.
   * \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile()
   *   using pre_data speeds compilation if it's done multiple times.
   *   Owned by caller, no references are kept when this function returns.
   * \return Compiled script object, bound to the context that was active
   *   when this function was called. When run it will always use this
   *   context.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
      Local<Context> context, Source* source,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Returns a task which streams script data into V8, or NULL if the script
   * cannot be streamed. The user is responsible for running the task on a
   * background thread and deleting it. When ran, the task starts parsing the
   * script, and it will request data from the StreamedSource as needed. When
   * ScriptStreamingTask::Run exits, all data has been streamed and the script
   * can be compiled (see Compile below).
   *
   * This API allows to start the streaming with as little data as possible, and
   * the remaining data (for example, the ScriptOrigin) is passed to Compile.
   */
  static ScriptStreamingTask* StartStreaming(
      Isolate* isolate, StreamedSource* source,
      ScriptType type = ScriptType::kClassic,
      CompileOptions options = kNoCompileOptions,
      CompileHintCallback compile_hint_callback = nullptr,
      void* compile_hint_callback_data = nullptr);

  static ConsumeCodeCacheTask* StartConsumingCodeCache(
      Isolate* isolate, std::unique_ptr<CachedData> source);

  /**
   * Compiles a streamed script (bound to current context).
   *
   * This can only be called after the streaming has finished
   * (ScriptStreamingTask has been run). V8 doesn't construct the source string
   * during streaming, so the embedder needs to pass the full source here.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
      Local<Context> context, StreamedSource* source,
      Local<String> full_source_string, const ScriptOrigin& origin);

  /**
   * Return a version tag for CachedData for the current V8 version & flags.
   *
   * This value is meant only for determining whether a previously generated
   * CachedData instance is still valid; the tag has no other meaing.
   *
   * Background: The data carried by CachedData may depend on the exact
   *   V8 version number or current compiler flags. This means that when
   *   persisting CachedData, the embedder must take care to not pass in
   *   data from another V8 version, or the same version with different
   *   features enabled.
   *
   *   The easiest way to do so is to clear the embedder's cache on any
   *   such change.
   *
   *   Alternatively, this tag can be stored alongside the cached data and
   *   compared when it is being used.
   */
  static uint32_t CachedDataVersionTag();

  /**
   * Compile an ES module, returning a Module that encapsulates
   * the compiled code.
   *
   * Corresponds to the ParseModule abstract operation in the
   * ECMAScript specification.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule(
      Isolate* isolate, Source* source,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Compiles a streamed module script.
   *
   * This can only be called after the streaming has finished
   * (ScriptStreamingTask has been run). V8 doesn't construct the source string
   * during streaming, so the embedder needs to pass the full source here.
   */
  static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule(
      Local<Context> context, StreamedSource* v8_source,
      Local<String> full_source_string, const ScriptOrigin& origin);

  /**
   * Compile a function for a given context. This is equivalent to running
   *
   * with (obj) {
   *   return function(args) { ... }
   * }
   *
   * It is possible to specify multiple context extensions (obj in the above
   * example).
   */
  V8_DEPRECATED("Use CompileFunction")
  static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext(
      Local<Context> context, Source* source, size_t arguments_count,
      Local<String> arguments[], size_t context_extension_count,
      Local<Object> context_extensions[],
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason,
      Local<ScriptOrModule>* script_or_module_out = nullptr);

  static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunction(
      Local<Context> context, Source* source, size_t arguments_count = 0,
      Local<String> arguments[] = nullptr, size_t context_extension_count = 0,
      Local<Object> context_extensions[] = nullptr,
      CompileOptions options = kNoCompileOptions,
      NoCacheReason no_cache_reason = kNoCacheNoReason);

  /**
   * Creates and returns code cache for the specified unbound_script.
   * This will return nullptr if the script cannot be serialized. The
   * CachedData returned by this function should be owned by the caller.
   */
  static CachedData* CreateCodeCache(Local<UnboundScript> unbound_script);

  /**
   * Creates and returns code cache for the specified unbound_module_script.
   * This will return nullptr if the script cannot be serialized. The
   * CachedData returned by this function should be owned by the caller.
   */
  static CachedData* CreateCodeCache(
      Local<UnboundModuleScript> unbound_module_script);

  /**
   * Creates and returns code cache for the specified function that was
   * previously produced by CompileFunction.
   * This will return nullptr if the script cannot be serialized. The
   * CachedData returned by this function should be owned by the caller.
   */
  static CachedData* CreateCodeCacheForFunction(Local<Function> function);

 private:
  static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal(
      Isolate* isolate, Source* source, CompileOptions options,
      NoCacheReason no_cache_reason);

  static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInternal(
      Local<Context> context, Source* source, size_t arguments_count,
      Local<String> arguments[], size_t context_extension_count,
      Local<Object> context_extensions[], CompileOptions options,
      NoCacheReason no_cache_reason,
      Local<ScriptOrModule>* script_or_module_out);
};

ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin,
                               CachedData* data,
                               ConsumeCodeCacheTask* consume_cache_task)
    : source_string(string),
      resource_name(origin.ResourceName()),
      resource_line_offset(origin.LineOffset()),
      resource_column_offset(origin.ColumnOffset()),
      resource_options(origin.Options()),
      source_map_url(origin.SourceMapUrl()),
      host_defined_options(origin.GetHostDefinedOptions()),
      cached_data(data),
      consume_cache_task(consume_cache_task) {}

ScriptCompiler::Source::Source(Local<String> string, CachedData* data,
                               ConsumeCodeCacheTask* consume_cache_task)
    : source_string(string),
      cached_data(data),
      consume_cache_task(consume_cache_task) {}

ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin,
                               CompileHintCallback callback,
                               void* callback_data)
    : source_string(string),
      resource_name(origin.ResourceName()),
      resource_line_offset(origin.LineOffset()),
      resource_column_offset(origin.ColumnOffset()),
      resource_options(origin.Options()),
      source_map_url(origin.SourceMapUrl()),
      host_defined_options(origin.GetHostDefinedOptions()),
      compile_hint_callback(callback),
      compile_hint_callback_data(callback_data) {}

const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData()
    const {
  return cached_data.get();
}

const ScriptOriginOptions& ScriptCompiler::Source::GetResourceOptions() const {
  return resource_options;
}

const ScriptCompiler::CompilationDetails&
ScriptCompiler::Source::GetCompilationDetails() const {
  return compilation_details;
}

ModuleRequest* ModuleRequest::Cast(Data* data) {
#ifdef V8_ENABLE_CHECKS
  CheckCast(data);
#endif
  return reinterpret_cast<ModuleRequest*>(data);
}

Module* Module::Cast(Data* data) {
#ifdef V8_ENABLE_CHECKS
  CheckCast(data);
#endif
  return reinterpret_cast<Module*>(data);
}

}  // namespace v8

#endif  // INCLUDE_V8_SCRIPT_H_